About 4-chloro-5-fluoro-1,6-dimethylindole
4-chloro-5-fluoro-1,6-dimethylindole (PubChem CID 126583354) has the molecular formula C10H9ClFN
and a molecular weight of 197.64 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1,6-dimethylindole.
Molecular Properties
| Compound Name | 4-chloro-5-fluoro-1,6-dimethylindole |
| PubChem CID | 126583354 |
| Molecular Formula | C10H9ClFN |
| Molecular Weight | 197.64 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 4-chloro-5-fluoro-1,6-dimethylindole |
| SMILES | Cc1cc2c(ccn2C)c(Cl)c1F |
| InChI | InChI=1S/C10H9ClFN/c1-6-5-8-7(3-4-13(8)2)9(11)10(6)12/h3-5H,1-2H3 |
| InChIKey | BQMGWEQPIHIGEE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-5-fluoro-1,6-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-fluoro-1,6-dimethylindole?
The IUPAC name of 4-chloro-5-fluoro-1,6-dimethylindole (CID 126583354) is 4-chloro-5-fluoro-1,6-dimethylindole.
What is the SMILES notation for 4-chloro-5-fluoro-1,6-dimethylindole?
The canonical SMILES for 4-chloro-5-fluoro-1,6-dimethylindole is Cc1cc2c(ccn2C)c(Cl)c1F.
What is the InChIKey of 4-chloro-5-fluoro-1,6-dimethylindole?
The InChIKey is BQMGWEQPIHIGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClFN/c1-6-5-8-7(3-4-13(8)2)9(11)10(6)12/h3-5H,1-2H3.
What are the key properties of 4-chloro-5-fluoro-1,6-dimethylindole?
4-chloro-5-fluoro-1,6-dimethylindole has a molecular weight of 197.64 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-fluoro-1,6-dimethylindole is sourced from PubChem (CID 126583354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).