C20H37NO2 — CID 126583476
(1Z,7Z)-N-(3-methoxypropyl)-N,2-dimethyl-6-(2-methylbutoxy)nona-1,5,7-trien-1-amine (PubChem CID 126583476) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is (1Z,7Z)-N-(3-methoxypropyl)-N,2-dimethyl-6-(2-methylbutoxy)nona-1,5,7-trien-1-amine.
| Compound Name | (1Z,7Z)-N-(3-methoxypropyl)-N,2-dimethyl-6-(2-methylbutoxy)nona-1,5,7-trien-1-amine |
|---|---|
| PubChem CID | 126583476 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | (1Z,7Z)-N-(3-methoxypropyl)-N,2-dimethyl-6-(2-methylbutoxy)nona-1,5,7-trien-1-amine |
| SMILES | C/C=C\C(=CCC/C(C)=C\N(C)CCCOC)OCC(C)CC |
| InChI | InChI=1S/C20H37NO2/c1-7-11-20(23-17-18(3)8-2)13-9-12-19(4)16-21(5)14-10-15-22-6/h7,11,13,16,18H,8-10,12,14-15,17H2,1-6H3/b11-7-,19-16-,20-13? |
| InChIKey | TYBQZVLHSKRMBQ-ZDHQCQPDSA-N |
| XLogP | 5.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|