C14H24N2O2 — CID 126583576
N-[(E)-4-[[(1Z,4Z)-hexa-1,4-dienyl]amino]but-2-enyl]-2-methoxypropanamide (PubChem CID 126583576) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[(E)-4-[[(1Z,4Z)-hexa-1,4-dienyl]amino]but-2-enyl]-2-methoxypropanamide.
| Compound Name | N-[(E)-4-[[(1Z,4Z)-hexa-1,4-dienyl]amino]but-2-enyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 126583576 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-[(E)-4-[[(1Z,4Z)-hexa-1,4-dienyl]amino]but-2-enyl]-2-methoxypropanamide |
| SMILES | C/C=C\C/C=C\NC/C=C/CNC(=O)C(C)OC |
| InChI | InChI=1S/C14H24N2O2/c1-4-5-6-7-10-15-11-8-9-12-16-14(17)13(2)18-3/h4-5,7-10,13,15H,6,11-12H2,1-3H3,(H,16,17)/b5-4-,9-8+,10-7- |
| InChIKey | YZBDIBPKDRWESX-CDHTUGOUSA-N |
| XLogP | 1.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|