C9H14N2 — CID 126583634
(2E,4Z,6E)-8-imino-4-methylocta-2,4,6-trien-2-amine (PubChem CID 126583634) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E,4Z,6E)-8-imino-4-methylocta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6E)-8-imino-4-methylocta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 126583634 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2E,4Z,6E)-8-imino-4-methylocta-2,4,6-trien-2-amine |
| SMILES | [H]/N=C/C=C/C=C(C)\C=C(/C)N |
| InChI | InChI=1S/C9H14N2/c1-8(7-9(2)11)5-3-4-6-10/h3-7,10H,11H2,1-2H3/b4-3+,8-5-,9-7+,10-6+ |
| InChIKey | NHVLNEDYKPPXJU-BITYAHCDSA-N |
| XLogP | 2.00 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|