About 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine
4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine (PubChem CID 126583837) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine.
Molecular Properties
| Compound Name | 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine |
| PubChem CID | 126583837 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine |
| SMILES | C=C(/C=C(\C)c1ccncc1)[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O2/c1-8(7-9(2)12(13)14)10-3-5-11-6-4-10/h3-7H,2H2,1H3/b8-7+ |
| InChIKey | MCRGEPMIRUPXBP-BQYQJAHWSA-N |
| XLogP | 2.28 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine?
The IUPAC name of 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine (CID 126583837) is 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine.
What is the SMILES notation for 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine?
The canonical SMILES for 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine is C=C(/C=C(\C)c1ccncc1)[N+](=O)[O-].
What is the InChIKey of 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine?
The InChIKey is MCRGEPMIRUPXBP-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-8(7-9(2)12(13)14)10-3-5-11-6-4-10/h3-7H,2H2,1H3/b8-7+.
What are the key properties of 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine?
4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine has a molecular weight of 190.20 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-4-nitropenta-2,4-dien-2-yl]pyridine is sourced from PubChem (CID 126583837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).