About 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid
2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid (PubChem CID 126584122) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid |
| PubChem CID | 126584122 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(N)C(=O)O)c2cc(-c3ccncc3)ccc2n1C |
| InChI | InChI=1S/C18H19N3O2/c1-11-14(10-16(19)18(22)23)15-9-13(3-4-17(15)21(11)2)12-5-7-20-8-6-12/h3-9,16H,10,19H2,1-2H3,(H,22,23) |
| InChIKey | BHWWJQDUYUIRHY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid (CID 126584122) is 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid is Cc1c(CC(N)C(=O)O)c2cc(-c3ccncc3)ccc2n1C.
What is the InChIKey of 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid?
The InChIKey is BHWWJQDUYUIRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2/c1-11-14(10-16(19)18(22)23)15-9-13(3-4-17(15)21(11)2)12-5-7-20-8-6-12/h3-9,16H,10,19H2,1-2H3,(H,22,23).
What are the key properties of 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid?
2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid has a molecular weight of 309.37 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,2-dimethyl-5-pyridin-4-ylindol-3-yl)propanoic acid is sourced from PubChem (CID 126584122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).