C46H82O10 — CID 126584476
1-[5-[8-(2-ethylhexoxy)-8-oxooctyl]-2-oxo-1,3-dioxolan-4-yl]octan-2-yl 8-(5-octyl-2-oxo-1,3-dioxolan-4-yl)octanoate (PubChem CID 126584476) has the molecular formula C46H82O10 and a molecular weight of 795.15 g/mol. Its IUPAC name is 1-[5-[8-(2-ethylhexoxy)-8-oxooctyl]-2-oxo-1,3-dioxolan-4-yl]octan-2-yl 8-(5-octyl-2-oxo-1,3-dioxolan-4-yl)octanoate.
| Compound Name | 1-[5-[8-(2-ethylhexoxy)-8-oxooctyl]-2-oxo-1,3-dioxolan-4-yl]octan-2-yl 8-(5-octyl-2-oxo-1,3-dioxolan-4-yl)octanoate |
|---|---|
| PubChem CID | 126584476 |
| Molecular Formula | C46H82O10 |
| Molecular Weight | 795.15 g/mol |
| Exact Mass | 794.59 |
| IUPAC Name | 1-[5-[8-(2-ethylhexoxy)-8-oxooctyl]-2-oxo-1,3-dioxolan-4-yl]octan-2-yl 8-(5-octyl-2-oxo-1,3-dioxolan-4-yl)octanoate |
| SMILES | CCCCCCCCC1OC(=O)OC1CCCCCCCC(=O)OC(CCCCCC)CC1OC(=O)OC1CCCCCCCC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C46H82O10/c1-5-9-12-14-17-23-30-39-40(54-45(49)53-39)31-24-18-16-21-27-34-44(48)52-38(29-22-13-10-6-2)35-42-41(55-46(50)56-42)32-25-19-15-20-26-33-43(47)51-36-37(8-4)28-11-7-3/h37-42H,5-36H2,1-4H3 |
| InChIKey | SOGKVKHXLGYHSV-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.15 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|