C28H36FN3O4 — CID 126585221
ethyl 3-[3-[(Z)-2-amino-3-(N-amino-2-fluoro-5-methoxyanilino)-3-(5,5-dimethylcyclopenten-1-yl)prop-2-enoxy]phenyl]propanoate (PubChem CID 126585221) has the molecular formula C28H36FN3O4 and a molecular weight of 497.61 g/mol. Its IUPAC name is ethyl 3-[3-[(Z)-2-amino-3-(N-amino-2-fluoro-5-methoxyanilino)-3-(5,5-dimethylcyclopenten-1-yl)prop-2-enoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[3-[(Z)-2-amino-3-(N-amino-2-fluoro-5-methoxyanilino)-3-(5,5-dimethylcyclopenten-1-yl)prop-2-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 126585221 |
| Molecular Formula | C28H36FN3O4 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | ethyl 3-[3-[(Z)-2-amino-3-(N-amino-2-fluoro-5-methoxyanilino)-3-(5,5-dimethylcyclopenten-1-yl)prop-2-enoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cccc(OC/C(N)=C(\C2=CCCC2(C)C)N(N)c2cc(OC)ccc2F)c1 |
| InChI | InChI=1S/C28H36FN3O4/c1-5-35-26(33)14-11-19-8-6-9-21(16-19)36-18-24(30)27(22-10-7-15-28(22,2)3)32(31)25-17-20(34-4)12-13-23(25)29/h6,8-10,12-13,16-17H,5,7,11,14-15,18,30-31H2,1-4H3/b27-24- |
| InChIKey | QVEPYFDJQADZTD-PNHLSOANSA-N |
| XLogP | 5.01 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|