About methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate
methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 126585479) has the molecular formula C16H24N4O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
| PubChem CID | 126585479 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | COC(=O)N1CCc2nc(C)n(C3CC4CCC(C3)N4)c2C1 |
| InChI | InChI=1S/C16H24N4O2/c1-10-17-14-5-6-19(16(21)22-2)9-15(14)20(10)13-7-11-3-4-12(8-13)18-11/h11-13,18H,3-9H2,1-2H3 |
| InChIKey | SHSDVXOJIGOPPJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate?
The IUPAC name of methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate (CID 126585479) is methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate.
What is the SMILES notation for methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate?
The canonical SMILES for methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate is COC(=O)N1CCc2nc(C)n(C3CC4CCC(C3)N4)c2C1.
What is the InChIKey of methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate?
The InChIKey is SHSDVXOJIGOPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O2/c1-10-17-14-5-6-19(16(21)22-2)9-15(14)20(10)13-7-11-3-4-12(8-13)18-11/h11-13,18H,3-9H2,1-2H3.
What are the key properties of methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate?
methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate has a molecular weight of 304.39 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate is sourced from PubChem (CID 126585479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).