About 2,4-di(propan-2-yl)-4H-1,3-benzodioxine
2,4-di(propan-2-yl)-4H-1,3-benzodioxine (PubChem CID 12658555) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 2,4-di(propan-2-yl)-4H-1,3-benzodioxine |
| PubChem CID | 12658555 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,4-di(propan-2-yl)-4H-1,3-benzodioxine |
| SMILES | CC(C)C1Oc2ccccc2C(C(C)C)O1 |
| InChI | InChI=1S/C14H20O2/c1-9(2)13-11-7-5-6-8-12(11)15-14(16-13)10(3)4/h5-10,13-14H,1-4H3 |
| InChIKey | URFBZONYAZIQQX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-di(propan-2-yl)-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-di(propan-2-yl)-4H-1,3-benzodioxine?
The IUPAC name of 2,4-di(propan-2-yl)-4H-1,3-benzodioxine (CID 12658555) is 2,4-di(propan-2-yl)-4H-1,3-benzodioxine.
What is the SMILES notation for 2,4-di(propan-2-yl)-4H-1,3-benzodioxine?
The canonical SMILES for 2,4-di(propan-2-yl)-4H-1,3-benzodioxine is CC(C)C1Oc2ccccc2C(C(C)C)O1.
What is the InChIKey of 2,4-di(propan-2-yl)-4H-1,3-benzodioxine?
The InChIKey is URFBZONYAZIQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-9(2)13-11-7-5-6-8-12(11)15-14(16-13)10(3)4/h5-10,13-14H,1-4H3.
What are the key properties of 2,4-di(propan-2-yl)-4H-1,3-benzodioxine?
2,4-di(propan-2-yl)-4H-1,3-benzodioxine has a molecular weight of 220.31 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-di(propan-2-yl)-4H-1,3-benzodioxine is sourced from PubChem (CID 12658555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).