C20H18ClN3O3 — CID 126586127
methyl 2-chloro-3-hydroxy-5-[2-[(3-methylphenyl)methylamino]pyrimidin-5-yl]benzoate (PubChem CID 126586127) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is methyl 2-chloro-3-hydroxy-5-[2-[(3-methylphenyl)methylamino]pyrimidin-5-yl]benzoate.
| Compound Name | methyl 2-chloro-3-hydroxy-5-[2-[(3-methylphenyl)methylamino]pyrimidin-5-yl]benzoate |
|---|---|
| PubChem CID | 126586127 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | methyl 2-chloro-3-hydroxy-5-[2-[(3-methylphenyl)methylamino]pyrimidin-5-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2cnc(NCc3cccc(C)c3)nc2)cc(O)c1Cl |
| InChI | InChI=1S/C20H18ClN3O3/c1-12-4-3-5-13(6-12)9-22-20-23-10-15(11-24-20)14-7-16(19(26)27-2)18(21)17(25)8-14/h3-8,10-11,25H,9H2,1-2H3,(H,22,23,24) |
| InChIKey | JAWXPBITOVQDAK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |