C10H18O — CID 126586487
(2R,3S,5S)-3-methyl-2-[(2R)-pent-4-en-2-yl]-5-tritiooxolane (PubChem CID 126586487) has the molecular formula C10H18O and a molecular weight of 156.26 g/mol. Its IUPAC name is (2R,3S,5S)-3-methyl-2-[(2R)-pent-4-en-2-yl]-5-tritiooxolane.
| Compound Name | (2R,3S,5S)-3-methyl-2-[(2R)-pent-4-en-2-yl]-5-tritiooxolane |
|---|---|
| PubChem CID | 126586487 |
| Molecular Formula | C10H18O |
| Molecular Weight | 156.26 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | (2R,3S,5S)-3-methyl-2-[(2R)-pent-4-en-2-yl]-5-tritiooxolane |
| SMILES | [3H][C@H]1C[C@H](C)[C@@H]([C@H](C)CC=C)O1 |
| InChI | InChI=1S/C10H18O/c1-4-5-8(2)10-9(3)6-7-11-10/h4,8-10H,1,5-7H2,2-3H3/t8-,9+,10-/m1/s1/i7T/t7-,8+,9-,10+/m0 |
| InChIKey | GSXACQNAFRYWCB-DQLCPIODSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|