About 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one
1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one (PubChem CID 126586490) has the molecular formula C9H16O2
and a molecular weight of 158.23 g/mol. Its IUPAC name is 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one.
Molecular Properties
| Compound Name | 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one |
| PubChem CID | 126586490 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one |
| SMILES | [3H][C@H]1C[C@H](C)[C@@H](C(=O)CCC)O1 |
| InChI | InChI=1S/C9H16O2/c1-3-4-8(10)9-7(2)5-6-11-9/h7,9H,3-6H2,1-2H3/t7-,9-/m0/s1/i6T/t6-,7-,9- |
| InChIKey | PUYZAITXUNXLSY-MBKGANGGSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one?
The IUPAC name of 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one (CID 126586490) is 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one.
What is the SMILES notation for 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one?
The canonical SMILES for 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one is [3H][C@H]1C[C@H](C)[C@@H](C(=O)CCC)O1.
What is the InChIKey of 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one?
The InChIKey is PUYZAITXUNXLSY-MBKGANGGSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-4-8(10)9-7(2)5-6-11-9/h7,9H,3-6H2,1-2H3/t7-,9-/m0/s1/i6T/t6-,7-,9-.
What are the key properties of 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one?
1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one has a molecular weight of 158.23 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butan-1-one is sourced from PubChem (CID 126586490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).