C9H17BrOS — CID 126586509
(1R)-4-bromo-1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butane-1-thiol (PubChem CID 126586509) has the molecular formula C9H17BrOS and a molecular weight of 255.21 g/mol. Its IUPAC name is (1R)-4-bromo-1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butane-1-thiol.
| Compound Name | (1R)-4-bromo-1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butane-1-thiol |
|---|---|
| PubChem CID | 126586509 |
| Molecular Formula | C9H17BrOS |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (1R)-4-bromo-1-[(2S,3S,5S)-3-methyl-5-tritiooxolan-2-yl]butane-1-thiol |
| SMILES | [3H][C@H]1C[C@H](C)[C@@H]([C@H](S)CCCBr)O1 |
| InChI | InChI=1S/C9H17BrOS/c1-7-4-6-11-9(7)8(12)3-2-5-10/h7-9,12H,2-6H2,1H3/t7-,8+,9-/m0/s1/i6T/t6-,7-,8+,9- |
| InChIKey | XLRHUSODBGAIDL-UNRMIZFSSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|