C16H25F — CID 126586971
(4E,6E)-9-fluoro-2,5,9-trimethyl-6-[(Z)-prop-1-enyl]deca-2,4,6-triene (PubChem CID 126586971) has the molecular formula C16H25F and a molecular weight of 236.37 g/mol. Its IUPAC name is (4E,6E)-9-fluoro-2,5,9-trimethyl-6-[(Z)-prop-1-enyl]deca-2,4,6-triene.
| Compound Name | (4E,6E)-9-fluoro-2,5,9-trimethyl-6-[(Z)-prop-1-enyl]deca-2,4,6-triene |
|---|---|
| PubChem CID | 126586971 |
| Molecular Formula | C16H25F |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (4E,6E)-9-fluoro-2,5,9-trimethyl-6-[(Z)-prop-1-enyl]deca-2,4,6-triene |
| SMILES | C/C=C\C(=C/CC(C)(C)F)\C(C)=C\C=C(C)C |
| InChI | InChI=1S/C16H25F/c1-7-8-15(11-12-16(5,6)17)14(4)10-9-13(2)3/h7-11H,12H2,1-6H3/b8-7-,14-10+,15-11+ |
| InChIKey | BNCZAWIFZYHTJM-ZFEFXFFSSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|