About 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine
2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine (PubChem CID 126587146) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine.
Molecular Properties
| Compound Name | 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine |
| PubChem CID | 126587146 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine |
| SMILES | [H]/N=C(\CCl)C1C=CC=CC1 |
| InChI | InChI=1S/C8H10ClN/c9-6-8(10)7-4-2-1-3-5-7/h1-4,7,10H,5-6H2/b10-8+ |
| InChIKey | YGAXONXBHODQCQ-CSKARUKUSA-N |
| XLogP | 2.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine?
The IUPAC name of 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine (CID 126587146) is 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine.
What is the SMILES notation for 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine?
The canonical SMILES for 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine is [H]/N=C(\CCl)C1C=CC=CC1.
What is the InChIKey of 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine?
The InChIKey is YGAXONXBHODQCQ-CSKARUKUSA-N. The full InChI is InChI=1S/C8H10ClN/c9-6-8(10)7-4-2-1-3-5-7/h1-4,7,10H,5-6H2/b10-8+.
What are the key properties of 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine?
2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine has a molecular weight of 155.63 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-cyclohexa-2,4-dien-1-ylethanimine is sourced from PubChem (CID 126587146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).