About methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate
methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate (PubChem CID 126587390) has the molecular formula C7H11NS2
and a molecular weight of 173.31 g/mol. Its IUPAC name is methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate.
Molecular Properties
| Compound Name | methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate |
| PubChem CID | 126587390 |
| Molecular Formula | C7H11NS2 |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate |
| SMILES | C=C/C=C\C(=N\C)SSC |
| InChI | InChI=1S/C7H11NS2/c1-4-5-6-7(8-2)10-9-3/h4-6H,1H2,2-3H3/b6-5-,8-7- |
| InChIKey | CYHRFZWBOHOHSJ-ISTTXYCBSA-N |
| XLogP | 2.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate?
The IUPAC name of methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate (CID 126587390) is methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate.
What is the SMILES notation for methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate?
The canonical SMILES for methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate is C=C/C=C\C(=N\C)SSC.
What is the InChIKey of methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate?
The InChIKey is CYHRFZWBOHOHSJ-ISTTXYCBSA-N. The full InChI is InChI=1S/C7H11NS2/c1-4-5-6-7(8-2)10-9-3/h4-6H,1H2,2-3H3/b6-5-,8-7-.
What are the key properties of methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate?
methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate has a molecular weight of 173.31 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl (2Z)-N-methylpenta-2,4-dienimidothioate is sourced from PubChem (CID 126587390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).