About 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide
3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide (PubChem CID 126589446) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide |
| PubChem CID | 126589446 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide |
| SMILES | CC(CCO)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O4/c1-8(5-7-14)12-9(15)4-6-13-10(16)2-3-11(13)17/h2-3,8,14H,4-7H2,1H3,(H,12,15) |
| InChIKey | UADHGPCCLDFFNP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide (CID 126589446) is 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide is CC(CCO)NC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide?
The InChIKey is UADHGPCCLDFFNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-8(5-7-14)12-9(15)4-6-13-10(16)2-3-11(13)17/h2-3,8,14H,4-7H2,1H3,(H,12,15).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide?
3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide has a molecular weight of 240.26 g/mol, XLogP of -0.81, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-N-(4-hydroxybutan-2-yl)propanamide is sourced from PubChem (CID 126589446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).