About [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol
[[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol (PubChem CID 126589460) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol.
Molecular Properties
| Compound Name | [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol |
| PubChem CID | 126589460 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol |
| SMILES | C=C/C(=C\C)C[C@H](NCO)C(C)NC |
| InChI | InChI=1S/C11H22N2O/c1-5-10(6-2)7-11(13-8-14)9(3)12-4/h5-6,9,11-14H,1,7-8H2,2-4H3/b10-6+/t9?,11-/m0/s1 |
| InChIKey | SNDVOWNCRLJWHE-XIUVXPLTSA-N |
| XLogP | 1.02 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol?
The IUPAC name of [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol (CID 126589460) is [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol.
What is the SMILES notation for [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol?
The canonical SMILES for [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol is C=C/C(=C\C)C[C@H](NCO)C(C)NC.
What is the InChIKey of [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol?
The InChIKey is SNDVOWNCRLJWHE-XIUVXPLTSA-N. The full InChI is InChI=1S/C11H22N2O/c1-5-10(6-2)7-11(13-8-14)9(3)12-4/h5-6,9,11-14H,1,7-8H2,2-4H3/b10-6+/t9?,11-/m0/s1.
What are the key properties of [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol?
[[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol has a molecular weight of 198.31 g/mol, XLogP of 1.02, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(Z,3S)-5-ethenyl-2-(methylamino)hept-5-en-3-yl]amino]methanol is sourced from PubChem (CID 126589460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).