About (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide
(2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide (PubChem CID 126589503) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide.
Molecular Properties
| Compound Name | (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide |
| PubChem CID | 126589503 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide |
| SMILES | C=C/C=C(\C=C)C[C@H](N)C(N)=O |
| InChI | InChI=1S/C9H14N2O/c1-3-5-7(4-2)6-8(10)9(11)12/h3-5,8H,1-2,6,10H2,(H2,11,12)/b7-5+/t8-/m0/s1 |
| InChIKey | CMUBJKZFCKUTJH-IVGLGHLBSA-N |
| XLogP | 0.49 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide?
The IUPAC name of (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide (CID 126589503) is (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide.
What is the SMILES notation for (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide?
The canonical SMILES for (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide is C=C/C=C(\C=C)C[C@H](N)C(N)=O.
What is the InChIKey of (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide?
The InChIKey is CMUBJKZFCKUTJH-IVGLGHLBSA-N. The full InChI is InChI=1S/C9H14N2O/c1-3-5-7(4-2)6-8(10)9(11)12/h3-5,8H,1-2,6,10H2,(H2,11,12)/b7-5+/t8-/m0/s1.
What are the key properties of (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide?
(2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide has a molecular weight of 166.22 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4Z)-2-amino-4-ethenylhepta-4,6-dienamide is sourced from PubChem (CID 126589503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).