About (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol
(2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol (PubChem CID 126589686) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol |
| PubChem CID | 126589686 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol |
| SMILES | C=CC(C[C@@H](CO)NC(O)CN)CC(C)(C)C=C |
| InChI | InChI=1S/C14H28N2O2/c1-5-11(8-14(3,4)6-2)7-12(10-17)16-13(18)9-15/h5-6,11-13,16-18H,1-2,7-10,15H2,3-4H3/t11?,12-,13?/m0/s1 |
| InChIKey | BMGGMISKAHVTDX-CPCZMJQVSA-N |
| XLogP | 1.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol?
The IUPAC name of (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol (CID 126589686) is (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol.
What is the SMILES notation for (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol?
The canonical SMILES for (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol is C=CC(C[C@@H](CO)NC(O)CN)CC(C)(C)C=C.
What is the InChIKey of (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol?
The InChIKey is BMGGMISKAHVTDX-CPCZMJQVSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-5-11(8-14(3,4)6-2)7-12(10-17)16-13(18)9-15/h5-6,11-13,16-18H,1-2,7-10,15H2,3-4H3/t11?,12-,13?/m0/s1.
What are the key properties of (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol?
(2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol has a molecular weight of 256.39 g/mol, XLogP of 1.01, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2-amino-1-hydroxyethyl)amino]-4-ethenyl-6,6-dimethyloct-7-en-1-ol is sourced from PubChem (CID 126589686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).