C20H30N2 — CID 126589842
(Z,7Z)-4-methyl-5-methylidene-3-(2-methylprop-2-enyl)-7-[(2E)-2-propylidenepyrrolidin-3-ylidene]hept-3-en-2-imine (PubChem CID 126589842) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (Z,7Z)-4-methyl-5-methylidene-3-(2-methylprop-2-enyl)-7-[(2E)-2-propylidenepyrrolidin-3-ylidene]hept-3-en-2-imine.
| Compound Name | (Z,7Z)-4-methyl-5-methylidene-3-(2-methylprop-2-enyl)-7-[(2E)-2-propylidenepyrrolidin-3-ylidene]hept-3-en-2-imine |
|---|---|
| PubChem CID | 126589842 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (Z,7Z)-4-methyl-5-methylidene-3-(2-methylprop-2-enyl)-7-[(2E)-2-propylidenepyrrolidin-3-ylidene]hept-3-en-2-imine |
| SMILES | [H]/N=C(C)/C(CC(=C)C)=C(/C)C(=C)C/C=C1/CCN/C1=C/CC |
| InChI | InChI=1S/C20H30N2/c1-7-8-20-18(11-12-22-20)10-9-15(4)16(5)19(17(6)21)13-14(2)3/h8,10,21-22H,2,4,7,9,11-13H2,1,3,5-6H3/b18-10-,19-16-,20-8+,21-17+ |
| InChIKey | XNJFDZXFGBVCBE-VPJUHQJQSA-N |
| XLogP | 5.47 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|