About 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine
2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine (PubChem CID 126589995) has the molecular formula C21H21N
and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine |
| PubChem CID | 126589995 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine |
| SMILES | C=Cc1ccc(-c2cc(C)cc(C)c2)cc1C1C=CC=CN1 |
| InChI | InChI=1S/C21H21N/c1-4-17-8-9-18(19-12-15(2)11-16(3)13-19)14-20(17)21-7-5-6-10-22-21/h4-14,21-22H,1H2,2-3H3 |
| InChIKey | NYAQHPJUSSNHDT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine?
The IUPAC name of 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine (CID 126589995) is 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine.
What is the SMILES notation for 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine?
The canonical SMILES for 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine is C=Cc1ccc(-c2cc(C)cc(C)c2)cc1C1C=CC=CN1.
What is the InChIKey of 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine?
The InChIKey is NYAQHPJUSSNHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N/c1-4-17-8-9-18(19-12-15(2)11-16(3)13-19)14-20(17)21-7-5-6-10-22-21/h4-14,21-22H,1H2,2-3H3.
What are the key properties of 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine?
2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine has a molecular weight of 287.41 g/mol, XLogP of 5.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,5-dimethylphenyl)-2-ethenylphenyl]-1,2-dihydropyridine is sourced from PubChem (CID 126589995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).