C24H22N2O3 — CID 126590033
4,11-dibenzyl-10-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 126590033) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4,11-dibenzyl-10-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 4,11-dibenzyl-10-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 126590033 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4,11-dibenzyl-10-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | CC1=CC(=O)C2C3C(=O)N(Cc4ccccc4)C(=O)C3C1N2Cc1ccccc1 |
| InChI | InChI=1S/C24H22N2O3/c1-15-12-18(27)22-20-19(21(15)25(22)13-16-8-4-2-5-9-16)23(28)26(24(20)29)14-17-10-6-3-7-11-17/h2-12,19-22H,13-14H2,1H3 |
| InChIKey | RUYWVZVXMJEKEI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|