About N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine
N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine (PubChem CID 126590615) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine.
Molecular Properties
| Compound Name | N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine |
| PubChem CID | 126590615 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine |
| SMILES | C=N/C(=C\N=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H18N2/c1-8(2)12-7-9(11-6)10(3,4)5/h7H,6H2,1-5H3/b9-7- |
| InChIKey | PWSOSSLTGQVCLO-CLFYSBASSA-N |
| XLogP | 3.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine?
The IUPAC name of N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine (CID 126590615) is N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine.
What is the SMILES notation for N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine?
The canonical SMILES for N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine is C=N/C(=C\N=C(C)C)C(C)(C)C.
What is the InChIKey of N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine?
The InChIKey is PWSOSSLTGQVCLO-CLFYSBASSA-N. The full InChI is InChI=1S/C10H18N2/c1-8(2)12-7-9(11-6)10(3,4)5/h7H,6H2,1-5H3/b9-7-.
What are the key properties of N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine?
N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine has a molecular weight of 166.27 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-3,3-dimethyl-2-(methylideneamino)but-1-enyl]propan-2-imine is sourced from PubChem (CID 126590615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).