C31H46ClO2P — CID 126590693
1,3,7,9-tetratert-butyl-11-chloro-5-ethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 126590693) has the molecular formula C31H46ClO2P and a molecular weight of 517.13 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-11-chloro-5-ethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | 1,3,7,9-tetratert-butyl-11-chloro-5-ethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 126590693 |
| Molecular Formula | C31H46ClO2P |
| Molecular Weight | 517.13 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-11-chloro-5-ethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | CCC1c2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(Cl)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C |
| InChI | InChI=1S/C31H46ClO2P/c1-14-21-22-15-19(28(2,3)4)17-24(30(8,9)10)26(22)33-35(32)34-27-23(21)16-20(29(5,6)7)18-25(27)31(11,12)13/h15-18,21H,14H2,1-13H3 |
| InChIKey | LBBJMZHSSGLBFC-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.13 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|