C27H26F6N6O2 — CID 126590767
7-[2,4-bis(trifluoromethyl)phenyl]-N-[(2E,4E)-6-methoxy-5-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-yl]-8-methyl-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 126590767) has the molecular formula C27H26F6N6O2 and a molecular weight of 580.53 g/mol. Its IUPAC name is 7-[2,4-bis(trifluoromethyl)phenyl]-N-[(2E,4E)-6-methoxy-5-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-yl]-8-methyl-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | 7-[2,4-bis(trifluoromethyl)phenyl]-N-[(2E,4E)-6-methoxy-5-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-yl]-8-methyl-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 126590767 |
| Molecular Formula | C27H26F6N6O2 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 7-[2,4-bis(trifluoromethyl)phenyl]-N-[(2E,4E)-6-methoxy-5-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-yl]-8-methyl-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | C=C(OC)/C(=C\C=C(/C)Nc1ncc2c(n1)N(C)C(c1ccc(C(F)(F)F)cc1C(F)(F)F)CO2)n1cnc(C)c1 |
| InChI | InChI=1S/C27H26F6N6O2/c1-15(6-9-21(17(3)40-5)39-12-16(2)35-14-39)36-25-34-11-23-24(37-25)38(4)22(13-41-23)19-8-7-18(26(28,29)30)10-20(19)27(31,32)33/h6-12,14,22H,3,13H2,1-2,4-5H3,(H,34,36,37)/b15-6+,21-9+ |
| InChIKey | CWYKJMOIZFFXPY-LBTUIKDDSA-N |
| XLogP | 6.61 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|