C20H23FN6O — CID 126590781
N-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]-11-methyl-7,8,9,10-tetrahydro-6H-pyrimido[5,4-b][1,4]oxazonin-2-amine (PubChem CID 126590781) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]-11-methyl-7,8,9,10-tetrahydro-6H-pyrimido[5,4-b][1,4]oxazonin-2-amine.
| Compound Name | N-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]-11-methyl-7,8,9,10-tetrahydro-6H-pyrimido[5,4-b][1,4]oxazonin-2-amine |
|---|---|
| PubChem CID | 126590781 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]-11-methyl-7,8,9,10-tetrahydro-6H-pyrimido[5,4-b][1,4]oxazonin-2-amine |
| SMILES | Cc1cn(-c2ccc(Nc3ncc4c(n3)N(C)CCCCCO4)cc2F)cn1 |
| InChI | InChI=1S/C20H23FN6O/c1-14-12-27(13-23-14)17-7-6-15(10-16(17)21)24-20-22-11-18-19(25-20)26(2)8-4-3-5-9-28-18/h6-7,10-13H,3-5,8-9H2,1-2H3,(H,22,24,25) |
| InChIKey | ZMAJQKPIBMKYRY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |