C22H24N6O2 — CID 126590823
CID 126590823 (PubChem CID 126590823) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol.
| Compound Name | CID 126590823 |
|---|---|
| PubChem CID | 126590823 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | — |
| SMILES | COc1cc(Nc2ncc3c(n2)N(C)C2(CO3)CC23CCC3)ccc1-c1cn[nH]c1 |
| InChI | InChI=1S/C22H24N6O2/c1-28-19-18(30-13-22(28)12-21(22)6-3-7-21)11-23-20(27-19)26-15-4-5-16(17(8-15)29-2)14-9-24-25-10-14/h4-5,8-11H,3,6-7,12-13H2,1-2H3,(H,24,25)(H,23,26,27) |
| InChIKey | FWKNFPNMHWSWLU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |