About (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane
(1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 126591137) has the molecular formula C9H14F2N2
and a molecular weight of 188.22 g/mol. Its IUPAC name is (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 126591137 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | FC1(F)CN(CC2[C@H]3CNC[C@@H]23)C1 |
| InChI | InChI=1S/C9H14F2N2/c10-9(11)4-13(5-9)3-8-6-1-12-2-7(6)8/h6-8,12H,1-5H2/t6-,7+,8? |
| InChIKey | ABBVZUMZIRGSEZ-DHBOJHSNSA-N |
| XLogP | 0.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane?
The IUPAC name of (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane (CID 126591137) is (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane is FC1(F)CN(CC2[C@H]3CNC[C@@H]23)C1.
What is the InChIKey of (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane?
The InChIKey is ABBVZUMZIRGSEZ-DHBOJHSNSA-N. The full InChI is InChI=1S/C9H14F2N2/c10-9(11)4-13(5-9)3-8-6-1-12-2-7(6)8/h6-8,12H,1-5H2/t6-,7+,8?.
What are the key properties of (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane?
(1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane has a molecular weight of 188.22 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-6-[(3,3-difluoroazetidin-1-yl)methyl]-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 126591137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).