C14H17NO4 — CID 126591222
(3S,6R,7S)-4-methyl-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-6-ol (PubChem CID 126591222) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (3S,6R,7S)-4-methyl-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-6-ol.
| Compound Name | (3S,6R,7S)-4-methyl-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-6-ol |
|---|---|
| PubChem CID | 126591222 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3S,6R,7S)-4-methyl-9-phenyl-2,8,10-trioxa-4-azatricyclo[5.4.0.03,5]undecan-6-ol |
| SMILES | CN1C2[C@@H](O)[C@@H]3OC(c4ccccc4)OCC3O[C@@H]21 |
| InChI | InChI=1S/C14H17NO4/c1-15-10-11(16)12-9(18-13(10)15)7-17-14(19-12)8-5-3-2-4-6-8/h2-6,9-14,16H,7H2,1H3/t9?,10?,11-,12-,13+,14?,15?/m1/s1 |
| InChIKey | LJZIQJZXKKFSSG-VHKQSZSWSA-N |
| XLogP | 0.50 |
| TPSA | 50.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|