C15H21NO5 — CID 126591401
(2S,3S,4aR)-3-amino-2-methoxy-7-phenyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepin-4-ol (PubChem CID 126591401) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is (2S,3S,4aR)-3-amino-2-methoxy-7-phenyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepin-4-ol.
| Compound Name | (2S,3S,4aR)-3-amino-2-methoxy-7-phenyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepin-4-ol |
|---|---|
| PubChem CID | 126591401 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2S,3S,4aR)-3-amino-2-methoxy-7-phenyl-3,4,4a,5,9,9a-hexahydro-2H-pyrano[2,3-e][1,3]dioxepin-4-ol |
| SMILES | CO[C@H]1OC2COC(c3ccccc3)OC[C@@H]2C(O)[C@@H]1N |
| InChI | InChI=1S/C15H21NO5/c1-18-15-12(16)13(17)10-7-19-14(20-8-11(10)21-15)9-5-3-2-4-6-9/h2-6,10-15,17H,7-8,16H2,1H3/t10-,11?,12-,13?,14?,15-/m0/s1 |
| InChIKey | HOYIYYDFMAGBSG-VXLSKKRHSA-N |
| XLogP | 0.41 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |