C17H28O3 — CID 126591451
(3R,4R,5S)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-6-methylidene-1-oxaspiro[2.5]octane (PubChem CID 126591451) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3R,4R,5S)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-6-methylidene-1-oxaspiro[2.5]octane.
| Compound Name | (3R,4R,5S)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-6-methylidene-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 126591451 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (3R,4R,5S)-5-methoxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-6-methylidene-1-oxaspiro[2.5]octane |
| SMILES | C=C1CC[C@]2(CO2)[C@@H](C(C)(C)OCC=C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C17H28O3/c1-12(2)8-10-19-16(4,5)15-14(18-6)13(3)7-9-17(15)11-20-17/h8,14-15H,3,7,9-11H2,1-2,4-6H3/t14-,15-,17+/m1/s1 |
| InChIKey | LMPZVGAIEXKWGC-INMHGKMJSA-N |
| XLogP | 3.50 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|