About 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine
3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 126591726) has the molecular formula C18H24N6O
and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 126591726 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCCCCn1nc(-c2cc(C3CC3)on2)c2c(N)ncnc21 |
| InChI | InChI=1S/C18H24N6O/c1-2-3-4-5-6-9-24-18-15(17(19)20-11-21-18)16(22-24)13-10-14(25-23-13)12-7-8-12/h10-12H,2-9H2,1H3,(H2,19,20,21) |
| InChIKey | XZDHDAPDGKNDSA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine (CID 126591726) is 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine is CCCCCCCn1nc(-c2cc(C3CC3)on2)c2c(N)ncnc21.
What is the InChIKey of 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is XZDHDAPDGKNDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N6O/c1-2-3-4-5-6-9-24-18-15(17(19)20-11-21-18)16(22-24)13-10-14(25-23-13)12-7-8-12/h10-12H,2-9H2,1H3,(H2,19,20,21).
What are the key properties of 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine?
3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 340.43 g/mol, XLogP of 3.91, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclopropyl-1,2-oxazol-3-yl)-1-heptylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 126591726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).