C34H40FN3O4 — CID 126591957
(3-ethyl-16-fluoro-4,18,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10(33),11,13,15(20),16,18-decaen-5-yl)methanol (PubChem CID 126591957) has the molecular formula C34H40FN3O4 and a molecular weight of 573.71 g/mol. Its IUPAC name is (3-ethyl-16-fluoro-4,18,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10(33),11,13,15(20),16,18-decaen-5-yl)methanol.
| Compound Name | (3-ethyl-16-fluoro-4,18,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10(33),11,13,15(20),16,18-decaen-5-yl)methanol |
|---|---|
| PubChem CID | 126591957 |
| Molecular Formula | C34H40FN3O4 |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | (3-ethyl-16-fluoro-4,18,28-trimethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10(33),11,13,15(20),16,18-decaen-5-yl)methanol |
| SMILES | CCc1c(C)c(CO)c2nc3cn2c1N1CCC(C)(CC1)OCCOCCOc1cc(C)cc(F)c1-c1cccc-3c1 |
| InChI | InChI=1S/C34H40FN3O4/c1-5-26-23(3)27(21-39)32-36-29-20-38(32)33(26)37-11-9-34(4,10-12-37)42-16-14-40-13-15-41-30-18-22(2)17-28(35)31(30)25-8-6-7-24(29)19-25/h6-8,17-20,39H,5,9-16,21H2,1-4H3 |
| InChIKey | IHUMAVVXFXTFKM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 68.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|