About 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol
2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol (PubChem CID 126592241) has the molecular formula C21H28FN3O2
and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol.
Molecular Properties
| Compound Name | 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol |
| PubChem CID | 126592241 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol |
| SMILES | CC(CC(O)N1C2CC3CC1CC(O)(C3)C2)c1nn(C)c2cccc(F)c12 |
| InChI | InChI=1S/C21H28FN3O2/c1-12(20-19-16(22)4-3-5-17(19)24(2)23-20)6-18(26)25-14-7-13-8-15(25)11-21(27,9-13)10-14/h3-5,12-15,18,26-27H,6-11H2,1-2H3 |
| InChIKey | DVLKXUWXVKJBOJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol?
The IUPAC name of 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol (CID 126592241) is 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol.
What is the SMILES notation for 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol?
The canonical SMILES for 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol is CC(CC(O)N1C2CC3CC1CC(O)(C3)C2)c1nn(C)c2cccc(F)c12.
What is the InChIKey of 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol?
The InChIKey is DVLKXUWXVKJBOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28FN3O2/c1-12(20-19-16(22)4-3-5-17(19)24(2)23-20)6-18(26)25-14-7-13-8-15(25)11-21(27,9-13)10-14/h3-5,12-15,18,26-27H,6-11H2,1-2H3.
What are the key properties of 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol?
2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol has a molecular weight of 373.47 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-fluoro-1-methylindazol-3-yl)-1-hydroxybutyl]-2-azatricyclo[3.3.1.13,7]decan-5-ol is sourced from PubChem (CID 126592241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).