C19H13FS — CID 126592460
2-(2-fluoro-4-methylphenyl)dibenzothiophene (PubChem CID 126592460) has the molecular formula C19H13FS and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylphenyl)dibenzothiophene.
| Compound Name | 2-(2-fluoro-4-methylphenyl)dibenzothiophene |
|---|---|
| PubChem CID | 126592460 |
| Molecular Formula | C19H13FS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-(2-fluoro-4-methylphenyl)dibenzothiophene |
| SMILES | Cc1ccc(-c2ccc3sc4ccccc4c3c2)c(F)c1 |
| InChI | InChI=1S/C19H13FS/c1-12-6-8-14(17(20)10-12)13-7-9-19-16(11-13)15-4-2-3-5-18(15)21-19/h2-11H,1H3 |
| InChIKey | RUORIZQVWGAFON-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |