About methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate
methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate (PubChem CID 126592619) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate.
Molecular Properties
| Compound Name | methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate |
| PubChem CID | 126592619 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate |
| SMILES | C=N/C=C(Cl)\C=C(/C)C(=O)OC |
| InChI | InChI=1S/C8H10ClNO2/c1-6(8(11)12-3)4-7(9)5-10-2/h4-5H,2H2,1,3H3/b6-4+,7-5+ |
| InChIKey | LPQLWYLADBMOGE-YDFGWWAZSA-N |
| XLogP | 1.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate?
The IUPAC name of methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate (CID 126592619) is methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate.
What is the SMILES notation for methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate?
The canonical SMILES for methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate is C=N/C=C(Cl)\C=C(/C)C(=O)OC.
What is the InChIKey of methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate?
The InChIKey is LPQLWYLADBMOGE-YDFGWWAZSA-N. The full InChI is InChI=1S/C8H10ClNO2/c1-6(8(11)12-3)4-7(9)5-10-2/h4-5H,2H2,1,3H3/b6-4+,7-5+.
What are the key properties of methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate?
methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate has a molecular weight of 187.63 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E,4E)-4-chloro-2-methyl-5-(methylideneamino)penta-2,4-dienoate is sourced from PubChem (CID 126592619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).