C14H23N — CID 126592719
(9S)-3,9,10-trimethylundeca-1,2,10-trien-4-imine (PubChem CID 126592719) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (9S)-3,9,10-trimethylundeca-1,2,10-trien-4-imine.
| Compound Name | (9S)-3,9,10-trimethylundeca-1,2,10-trien-4-imine |
|---|---|
| PubChem CID | 126592719 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (9S)-3,9,10-trimethylundeca-1,2,10-trien-4-imine |
| SMILES | [H]/N=C(\CCCC[C@H](C)C(=C)C)C(C)=C=C |
| InChI | InChI=1S/C14H23N/c1-6-12(4)14(15)10-8-7-9-13(5)11(2)3/h13,15H,1-2,7-10H2,3-5H3/b15-14+/t13-/m0/s1 |
| InChIKey | RPYWVBVPEGILDH-NPIURYIMSA-N |
| XLogP | 4.51 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|