About (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine
(3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine (PubChem CID 126592729) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine.
Molecular Properties
| Compound Name | (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine |
| PubChem CID | 126592729 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine |
| SMILES | [H]/N=C/C(=C)[C@H](C)C(CC)[C@@H](C)CCCC |
| InChI | InChI=1S/C14H27N/c1-6-8-9-11(3)14(7-2)13(5)12(4)10-15/h10-11,13-15H,4,6-9H2,1-3,5H3/b15-10+/t11-,13-,14?/m0/s1 |
| InChIKey | ASGQXDNMDGCSOI-VHJZQWEDSA-N |
| XLogP | 4.68 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine?
The IUPAC name of (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine (CID 126592729) is (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine.
What is the SMILES notation for (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine?
The canonical SMILES for (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine is [H]/N=C/C(=C)[C@H](C)C(CC)[C@@H](C)CCCC.
What is the InChIKey of (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine?
The InChIKey is ASGQXDNMDGCSOI-VHJZQWEDSA-N. The full InChI is InChI=1S/C14H27N/c1-6-8-9-11(3)14(7-2)13(5)12(4)10-15/h10-11,13-15H,4,6-9H2,1-3,5H3/b15-10+/t11-,13-,14?/m0/s1.
What are the key properties of (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine?
(3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine has a molecular weight of 209.38 g/mol, XLogP of 4.68, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-4-ethyl-3,5-dimethyl-2-methylidenenonan-1-imine is sourced from PubChem (CID 126592729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).