C14H19N — CID 126592731
(5Z,7E)-3-ethenylidene-7,8-dimethyldeca-5,7,9-trien-1-imine (PubChem CID 126592731) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (5Z,7E)-3-ethenylidene-7,8-dimethyldeca-5,7,9-trien-1-imine.
| Compound Name | (5Z,7E)-3-ethenylidene-7,8-dimethyldeca-5,7,9-trien-1-imine |
|---|---|
| PubChem CID | 126592731 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (5Z,7E)-3-ethenylidene-7,8-dimethyldeca-5,7,9-trien-1-imine |
| SMILES | [H]/N=C/CC(=C=C)C/C=C\C(C)=C(/C)C=C |
| InChI | InChI=1S/C14H19N/c1-5-12(3)13(4)8-7-9-14(6-2)10-11-15/h5,7-8,11,15H,1-2,9-10H2,3-4H3/b8-7-,13-12+,15-11+ |
| InChIKey | UVKHHZXJVAMMQR-ICCYDPCWSA-N |
| XLogP | 4.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|