C13H23N — CID 126592939
(8S)-2,8,9-trimethyldeca-1,9-dien-3-imine (PubChem CID 126592939) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (8S)-2,8,9-trimethyldeca-1,9-dien-3-imine.
| Compound Name | (8S)-2,8,9-trimethyldeca-1,9-dien-3-imine |
|---|---|
| PubChem CID | 126592939 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (8S)-2,8,9-trimethyldeca-1,9-dien-3-imine |
| SMILES | [H]/N=C(/CCCC[C@H](C)C(=C)C)C(=C)C |
| InChI | InChI=1S/C13H23N/c1-10(2)12(5)8-6-7-9-13(14)11(3)4/h12,14H,1,3,6-9H2,2,4-5H3/b14-13-/t12-/m0/s1 |
| InChIKey | LSAOGBPIQNSHDO-JOLOJFPGSA-N |
| XLogP | 4.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|