About 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine
4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine (PubChem CID 126593505) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine |
| PubChem CID | 126593505 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine |
| SMILES | C=C1NC(N)=NC(C)=C1N |
| InChI | InChI=1S/C6H10N4/c1-3-5(7)4(2)10-6(8)9-3/h1,7H2,2H3,(H3,8,9,10) |
| InChIKey | JCJBIDQZRSZORP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine?
The IUPAC name of 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine (CID 126593505) is 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine.
What is the SMILES notation for 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine?
The canonical SMILES for 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine is C=C1NC(N)=NC(C)=C1N.
What is the InChIKey of 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine?
The InChIKey is JCJBIDQZRSZORP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-3-5(7)4(2)10-6(8)9-3/h1,7H2,2H3,(H3,8,9,10).
What are the key properties of 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine?
4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine has a molecular weight of 138.17 g/mol, XLogP of -0.39, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-methylidene-1H-pyrimidine-2,5-diamine is sourced from PubChem (CID 126593505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).