About ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate
ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate (PubChem CID 126593682) has the molecular formula C25H21ClN2O2
and a molecular weight of 416.91 g/mol. Its IUPAC name is ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate |
| PubChem CID | 126593682 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2Cl)c2c(C)c(-c3ccncc3)c(C)cc2n1 |
| InChI | InChI=1S/C25H21ClN2O2/c1-4-30-25(29)22-14-19(18-7-5-6-8-20(18)26)24-16(3)23(15(2)13-21(24)28-22)17-9-11-27-12-10-17/h5-14H,4H2,1-3H3 |
| InChIKey | HTHLNNJLGNKAAG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate?
The IUPAC name of ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate (CID 126593682) is ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate.
What is the SMILES notation for ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate?
The canonical SMILES for ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate is CCOC(=O)c1cc(-c2ccccc2Cl)c2c(C)c(-c3ccncc3)c(C)cc2n1.
What is the InChIKey of ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate?
The InChIKey is HTHLNNJLGNKAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21ClN2O2/c1-4-30-25(29)22-14-19(18-7-5-6-8-20(18)26)24-16(3)23(15(2)13-21(24)28-22)17-9-11-27-12-10-17/h5-14H,4H2,1-3H3.
What are the key properties of ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate?
ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate has a molecular weight of 416.91 g/mol, XLogP of 6.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-chlorophenyl)-5,7-dimethyl-6-pyridin-4-ylquinoline-2-carboxylate is sourced from PubChem (CID 126593682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).