About 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine
4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine (PubChem CID 126593695) has the molecular formula C26H28N4O
and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine |
| PubChem CID | 126593695 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine |
| SMILES | Cc1cc2nccc(-c3ccnn3C)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H28N4O/c1-18-16-23-26(22(8-10-27-23)24-9-11-28-29(24)3)19(2)25(18)21-6-4-20(5-7-21)17-30-12-14-31-15-13-30/h4-11,16H,12-15,17H2,1-3H3 |
| InChIKey | TZPCPZGAYFZEIR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine?
The IUPAC name of 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine (CID 126593695) is 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine.
What is the SMILES notation for 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine?
The canonical SMILES for 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine is Cc1cc2nccc(-c3ccnn3C)c2c(C)c1-c1ccc(CN2CCOCC2)cc1.
What is the InChIKey of 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine?
The InChIKey is TZPCPZGAYFZEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N4O/c1-18-16-23-26(22(8-10-27-23)24-9-11-28-29(24)3)19(2)25(18)21-6-4-20(5-7-21)17-30-12-14-31-15-13-30/h4-11,16H,12-15,17H2,1-3H3.
What are the key properties of 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine?
4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine has a molecular weight of 412.54 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[5,7-dimethyl-4-(2-methylpyrazol-3-yl)quinolin-6-yl]phenyl]methyl]morpholine is sourced from PubChem (CID 126593695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).