About 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile
2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile (PubChem CID 126593761) has the molecular formula C29H27N3O
and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile |
| PubChem CID | 126593761 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile |
| SMILES | Cc1cc2nccc(-c3ccccc3C#N)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C29H27N3O/c1-20-17-27-29(26(11-12-31-27)25-6-4-3-5-24(25)18-30)21(2)28(20)23-9-7-22(8-10-23)19-32-13-15-33-16-14-32/h3-12,17H,13-16,19H2,1-2H3 |
| InChIKey | WDFQYUINJURXDB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile?
The IUPAC name of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile (CID 126593761) is 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile.
What is the SMILES notation for 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile?
The canonical SMILES for 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile is Cc1cc2nccc(-c3ccccc3C#N)c2c(C)c1-c1ccc(CN2CCOCC2)cc1.
What is the InChIKey of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile?
The InChIKey is WDFQYUINJURXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27N3O/c1-20-17-27-29(26(11-12-31-27)25-6-4-3-5-24(25)18-30)21(2)28(20)23-9-7-22(8-10-23)19-32-13-15-33-16-14-32/h3-12,17H,13-16,19H2,1-2H3.
What are the key properties of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile?
2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile has a molecular weight of 433.56 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzonitrile is sourced from PubChem (CID 126593761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).