About N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride
N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride (PubChem CID 126593825) has the molecular formula C6H11ClN4
and a molecular weight of 174.64 g/mol. Its IUPAC name is N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride.
Molecular Properties
| Compound Name | N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride |
| PubChem CID | 126593825 |
| Molecular Formula | C6H11ClN4 |
| Molecular Weight | 174.64 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride |
| SMILES | [H]/N=C(N)/C(N)=C(C)\N=C(/C)Cl |
| InChI | InChI=1S/C6H11ClN4/c1-3(11-4(2)7)5(8)6(9)10/h8H2,1-2H3,(H3,9,10)/b5-3+,11-4+ |
| InChIKey | WTPVNZIIBXIHBX-NIDLAPIMSA-N |
| XLogP | 0.77 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.64 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride?
The IUPAC name of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride (CID 126593825) is N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride.
What is the SMILES notation for N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride?
The canonical SMILES for N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride is [H]/N=C(N)/C(N)=C(C)\N=C(/C)Cl.
What is the InChIKey of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride?
The InChIKey is WTPVNZIIBXIHBX-NIDLAPIMSA-N. The full InChI is InChI=1S/C6H11ClN4/c1-3(11-4(2)7)5(8)6(9)10/h8H2,1-2H3,(H3,9,10)/b5-3+,11-4+.
What are the key properties of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride?
N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride has a molecular weight of 174.64 g/mol, XLogP of 0.77, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl chloride is sourced from PubChem (CID 126593825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).