C15H26N2 — CID 126593849
(3E,5E,7R)-5-(butylideneamino)-6,7-dimethylnona-1,3,5-trien-4-amine (PubChem CID 126593849) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (3E,5E,7R)-5-(butylideneamino)-6,7-dimethylnona-1,3,5-trien-4-amine.
| Compound Name | (3E,5E,7R)-5-(butylideneamino)-6,7-dimethylnona-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 126593849 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (3E,5E,7R)-5-(butylideneamino)-6,7-dimethylnona-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C(/N=C/CCC)=C(\C)[C@H](C)CC |
| InChI | InChI=1S/C15H26N2/c1-6-9-11-17-15(14(16)10-7-2)13(5)12(4)8-3/h7,10-12H,2,6,8-9,16H2,1,3-5H3/b14-10+,15-13+,17-11+/t12-/m1/s1 |
| InChIKey | CHLIKYACJQYSKK-JZBVZLBSSA-N |
| XLogP | 4.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|