C15H24N2 — CID 126593883
2,3,4-trimethyl-N'-[(E)-pent-1-enyl]cyclohexa-1,5-diene-1-carboximidamide (PubChem CID 126593883) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2,3,4-trimethyl-N'-[(E)-pent-1-enyl]cyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | 2,3,4-trimethyl-N'-[(E)-pent-1-enyl]cyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 126593883 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2,3,4-trimethyl-N'-[(E)-pent-1-enyl]cyclohexa-1,5-diene-1-carboximidamide |
| SMILES | CCC/C=C/N=C(\N)C1=C(C)C(C)C(C)C=C1 |
| InChI | InChI=1S/C15H24N2/c1-5-6-7-10-17-15(16)14-9-8-11(2)12(3)13(14)4/h7-12H,5-6H2,1-4H3,(H2,16,17)/b10-7+ |
| InChIKey | RXTZCCAKJFYJPT-JXMROGBWSA-N |
| XLogP | 3.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|