C16H25N — CID 126593885
N-[(E)-pent-1-enyl]-1-(2,3,4-trimethylcyclohexa-1,5-dien-1-yl)ethanimine (PubChem CID 126593885) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-[(E)-pent-1-enyl]-1-(2,3,4-trimethylcyclohexa-1,5-dien-1-yl)ethanimine.
| Compound Name | N-[(E)-pent-1-enyl]-1-(2,3,4-trimethylcyclohexa-1,5-dien-1-yl)ethanimine |
|---|---|
| PubChem CID | 126593885 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-[(E)-pent-1-enyl]-1-(2,3,4-trimethylcyclohexa-1,5-dien-1-yl)ethanimine |
| SMILES | CCC/C=C/N=C(\C)C1=C(C)C(C)C(C)C=C1 |
| InChI | InChI=1S/C16H25N/c1-6-7-8-11-17-15(5)16-10-9-12(2)13(3)14(16)4/h8-13H,6-7H2,1-5H3/b11-8+,17-15+ |
| InChIKey | YSEVHDBXYYHYND-JDRYRXCOSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|